C18H29NO4S — CID 91653153
N,N-diethyl-2-[[4-[2-(2-methoxyethoxy)ethoxy]phenyl]methylsulfanyl]acetamide (PubChem CID 91653153) has the molecular formula C18H29NO4S and a molecular weight of 355.50 g/mol. Its IUPAC name is N,N-diethyl-2-[[4-[2-(2-methoxyethoxy)ethoxy]phenyl]methylsulfanyl]acetamide.
| Compound Name | N,N-diethyl-2-[[4-[2-(2-methoxyethoxy)ethoxy]phenyl]methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 91653153 |
| Molecular Formula | C18H29NO4S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N,N-diethyl-2-[[4-[2-(2-methoxyethoxy)ethoxy]phenyl]methylsulfanyl]acetamide |
| SMILES | CCN(CC)C(=O)CSCc1ccc(OCCOCCOC)cc1 |
| InChI | InChI=1S/C18H29NO4S/c1-4-19(5-2)18(20)15-24-14-16-6-8-17(9-7-16)23-13-12-22-11-10-21-3/h6-9H,4-5,10-15H2,1-3H3 |
| InChIKey | WKUCDJAGRNCPDS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|