C15H21BrN2OS — CID 53278905
2-[(4-bromophenyl)methylsulfanyl]-N-(1-methylpiperidin-4-yl)acetamide (PubChem CID 53278905) has the molecular formula C15H21BrN2OS and a molecular weight of 357.32 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfanyl]-N-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-[(4-bromophenyl)methylsulfanyl]-N-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 53278905 |
| Molecular Formula | C15H21BrN2OS |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfanyl]-N-(1-methylpiperidin-4-yl)acetamide |
| SMILES | CN1CCC(NC(=O)CSCc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C15H21BrN2OS/c1-18-8-6-14(7-9-18)17-15(19)11-20-10-12-2-4-13(16)5-3-12/h2-5,14H,6-11H2,1H3,(H,17,19) |
| InChIKey | UFFSVTQMHSHLQA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |