C17H25NOS — CID 47005023
N-(4-methylcyclohexyl)-2-[(4-methylphenyl)methylsulfanyl]acetamide (PubChem CID 47005023) has the molecular formula C17H25NOS and a molecular weight of 291.46 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-2-[(4-methylphenyl)methylsulfanyl]acetamide.
| Compound Name | N-(4-methylcyclohexyl)-2-[(4-methylphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 47005023 |
| Molecular Formula | C17H25NOS |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-(4-methylcyclohexyl)-2-[(4-methylphenyl)methylsulfanyl]acetamide |
| SMILES | Cc1ccc(CSCC(=O)NC2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C17H25NOS/c1-13-3-7-15(8-4-13)11-20-12-17(19)18-16-9-5-14(2)6-10-16/h3-4,7-8,14,16H,5-6,9-12H2,1-2H3,(H,18,19) |
| InChIKey | QJSXNEOETWCPDS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |