C16H21NO3S — CID 7773294
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-[(4-methylphenyl)methylsulfanyl]acetate (PubChem CID 7773294) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-[(4-methylphenyl)methylsulfanyl]acetate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-[(4-methylphenyl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 7773294 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-[(4-methylphenyl)methylsulfanyl]acetate |
| SMILES | Cc1ccc(CSCC(=O)O[C@@H](C)C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C16H21NO3S/c1-11-3-5-13(6-4-11)9-21-10-15(18)20-12(2)16(19)17-14-7-8-14/h3-6,12,14H,7-10H2,1-2H3,(H,17,19)/t12-/m0/s1 |
| InChIKey | LUAVYHKJCWIQNU-LBPRGKRZSA-N |
| XLogP | 2.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |