C15H20N2O3 — CID 61315262
[1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(4-aminophenyl)propanoate (PubChem CID 61315262) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is [1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(4-aminophenyl)propanoate.
| Compound Name | [1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(4-aminophenyl)propanoate |
|---|---|
| PubChem CID | 61315262 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | [1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(4-aminophenyl)propanoate |
| SMILES | CC(OC(=O)CCc1ccc(N)cc1)C(=O)NC1CC1 |
| InChI | InChI=1S/C15H20N2O3/c1-10(15(19)17-13-7-8-13)20-14(18)9-4-11-2-5-12(16)6-3-11/h2-3,5-6,10,13H,4,7-9,16H2,1H3,(H,17,19) |
| InChIKey | VBHSQIJUHJNBSA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|