C22H34N2O5S — CID 46609591
[1-(cyclohexylamino)-1-oxopropan-2-yl] 3-[4-(diethylsulfamoyl)phenyl]propanoate (PubChem CID 46609591) has the molecular formula C22H34N2O5S and a molecular weight of 438.59 g/mol. Its IUPAC name is [1-(cyclohexylamino)-1-oxopropan-2-yl] 3-[4-(diethylsulfamoyl)phenyl]propanoate.
| Compound Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 3-[4-(diethylsulfamoyl)phenyl]propanoate |
|---|---|
| PubChem CID | 46609591 |
| Molecular Formula | C22H34N2O5S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 3-[4-(diethylsulfamoyl)phenyl]propanoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)OC(C)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C22H34N2O5S/c1-4-24(5-2)30(27,28)20-14-11-18(12-15-20)13-16-21(25)29-17(3)22(26)23-19-9-7-6-8-10-19/h11-12,14-15,17,19H,4-10,13,16H2,1-3H3,(H,23,26) |
| InChIKey | RREKJMIYDQAURS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |