C19H27NO3 — CID 8506853
[(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(4-tert-butylphenyl)propanoate (PubChem CID 8506853) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(4-tert-butylphenyl)propanoate.
| Compound Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(4-tert-butylphenyl)propanoate |
|---|---|
| PubChem CID | 8506853 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(4-tert-butylphenyl)propanoate |
| SMILES | C[C@@H](OC(=O)CCc1ccc(C(C)(C)C)cc1)C(=O)NC1CC1 |
| InChI | InChI=1S/C19H27NO3/c1-13(18(22)20-16-10-11-16)23-17(21)12-7-14-5-8-15(9-6-14)19(2,3)4/h5-6,8-9,13,16H,7,10-12H2,1-4H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | SXJOWJNJDLTCIB-CYBMUJFWSA-N |
| XLogP | 3.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |