C16H18FNO4 — CID 7764352
[(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 7764352) has the molecular formula C16H18FNO4 and a molecular weight of 307.32 g/mol. Its IUPAC name is [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 4-(4-fluorophenyl)-4-oxobutanoate.
| Compound Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7764352 |
| Molecular Formula | C16H18FNO4 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 4-(4-fluorophenyl)-4-oxobutanoate |
| SMILES | C[C@@H](OC(=O)CCC(=O)c1ccc(F)cc1)C(=O)NC1CC1 |
| InChI | InChI=1S/C16H18FNO4/c1-10(16(21)18-13-6-7-13)22-15(20)9-8-14(19)11-2-4-12(17)5-3-11/h2-5,10,13H,6-9H2,1H3,(H,18,21)/t10-/m1/s1 |
| InChIKey | YOJRBZTXIWLFHN-SNVBAGLBSA-N |
| XLogP | 2.00 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |