C25H39N3O4S — CID 55690819
N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-[4-(diethylsulfamoyl)phenyl]propanamide (PubChem CID 55690819) has the molecular formula C25H39N3O4S and a molecular weight of 477.67 g/mol. Its IUPAC name is N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-[4-(diethylsulfamoyl)phenyl]propanamide.
| Compound Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-[4-(diethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55690819 |
| Molecular Formula | C25H39N3O4S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-[4-(diethylsulfamoyl)phenyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)NC2CCN(C(=O)C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C25H39N3O4S/c1-3-28(4-2)33(31,32)23-13-10-20(11-14-23)12-15-24(29)26-22-16-18-27(19-17-22)25(30)21-8-6-5-7-9-21/h10-11,13-14,21-22H,3-9,12,15-19H2,1-2H3,(H,26,29) |
| InChIKey | LCAATJYISLUGCG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |