C24H33N3O5S2 — CID 28562876
3-[4-(diethylsulfamoyl)phenyl]-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]propanamide (PubChem CID 28562876) has the molecular formula C24H33N3O5S2 and a molecular weight of 507.68 g/mol. Its IUPAC name is 3-[4-(diethylsulfamoyl)phenyl]-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]propanamide.
| Compound Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 28562876 |
| Molecular Formula | C24H33N3O5S2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)NCc2ccc(S(=O)(=O)N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H33N3O5S2/c1-3-26(4-2)33(29,30)22-12-7-20(8-13-22)11-16-24(28)25-19-21-9-14-23(15-10-21)34(31,32)27-17-5-6-18-27/h7-10,12-15H,3-6,11,16-19H2,1-2H3,(H,25,28) |
| InChIKey | NTBULTWXDDKRQY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |