C23H31N3O5S2 — CID 24549133
N-[[4-(diethylsulfamoyl)phenyl]methyl]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 24549133) has the molecular formula C23H31N3O5S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is N-[[4-(diethylsulfamoyl)phenyl]methyl]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[[4-(diethylsulfamoyl)phenyl]methyl]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 24549133 |
| Molecular Formula | C23H31N3O5S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-[[4-(diethylsulfamoyl)phenyl]methyl]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C23H31N3O5S2/c1-3-25(4-2)32(28,29)21-12-8-19(9-13-21)18-24-23(27)20-10-14-22(15-11-20)33(30,31)26-16-6-5-7-17-26/h8-15H,3-7,16-18H2,1-2H3,(H,24,27) |
| InChIKey | QIOBQFOVAAFGKJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |