C23H32N4O5S2 — CID 29195584
N-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-4-(diethylsulfamoyl)benzamide (PubChem CID 29195584) has the molecular formula C23H32N4O5S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is N-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-4-(diethylsulfamoyl)benzamide.
| Compound Name | N-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-4-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 29195584 |
| Molecular Formula | C23H32N4O5S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | N-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-4-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCCN2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H32N4O5S2/c1-3-26(4-2)33(29,30)22-12-10-20(11-13-22)23(28)24-14-15-25-16-18-27(19-17-25)34(31,32)21-8-6-5-7-9-21/h5-13H,3-4,14-19H2,1-2H3,(H,24,28) |
| InChIKey | GZTBRVVEKCNKBG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |