C17H20BrN3O4S — CID 29195593
N-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-5-bromofuran-2-carboxamide (PubChem CID 29195593) has the molecular formula C17H20BrN3O4S and a molecular weight of 442.34 g/mol. Its IUPAC name is N-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-5-bromofuran-2-carboxamide.
| Compound Name | N-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 29195593 |
| Molecular Formula | C17H20BrN3O4S |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-5-bromofuran-2-carboxamide |
| SMILES | O=C(NCCN1CCN(S(=O)(=O)c2ccccc2)CC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C17H20BrN3O4S/c18-16-7-6-15(25-16)17(22)19-8-9-20-10-12-21(13-11-20)26(23,24)14-4-2-1-3-5-14/h1-7H,8-13H2,(H,19,22) |
| InChIKey | KGGMVXGRGJAKRA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |