C24H34N4O5S2 — CID 42175284
4-(diethylsulfamoyl)-N-[3-(4-phenylpiperazin-1-yl)sulfonylpropyl]benzamide (PubChem CID 42175284) has the molecular formula C24H34N4O5S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[3-(4-phenylpiperazin-1-yl)sulfonylpropyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[3-(4-phenylpiperazin-1-yl)sulfonylpropyl]benzamide |
|---|---|
| PubChem CID | 42175284 |
| Molecular Formula | C24H34N4O5S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[3-(4-phenylpiperazin-1-yl)sulfonylpropyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCCCS(=O)(=O)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H34N4O5S2/c1-3-27(4-2)35(32,33)23-13-11-21(12-14-23)24(29)25-15-8-20-34(30,31)28-18-16-26(17-19-28)22-9-6-5-7-10-22/h5-7,9-14H,3-4,8,15-20H2,1-2H3,(H,25,29) |
| InChIKey | ZSGYAIWDIKCECU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|