C25H35N3O5S2 — CID 28562799
3-[4-(tert-butylsulfamoyl)phenyl]-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]propanamide (PubChem CID 28562799) has the molecular formula C25H35N3O5S2 and a molecular weight of 521.71 g/mol. Its IUPAC name is 3-[4-(tert-butylsulfamoyl)phenyl]-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]propanamide.
| Compound Name | 3-[4-(tert-butylsulfamoyl)phenyl]-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 28562799 |
| Molecular Formula | C25H35N3O5S2 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 3-[4-(tert-butylsulfamoyl)phenyl]-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]propanamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(CCC(=O)NCc2ccc(S(=O)(=O)N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H35N3O5S2/c1-25(2,3)27-34(30,31)22-12-7-20(8-13-22)11-16-24(29)26-19-21-9-14-23(15-10-21)35(32,33)28-17-5-4-6-18-28/h7-10,12-15,27H,4-6,11,16-19H2,1-3H3,(H,26,29) |
| InChIKey | AEYHJYSPQKUJQT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |