C20H20N2O3S — CID 7773290
[(2S)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-[(4-methylphenyl)methylsulfanyl]acetate (PubChem CID 7773290) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is [(2S)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-[(4-methylphenyl)methylsulfanyl]acetate.
| Compound Name | [(2S)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-[(4-methylphenyl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 7773290 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | [(2S)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-[(4-methylphenyl)methylsulfanyl]acetate |
| SMILES | Cc1ccc(CSCC(=O)O[C@@H](C)C(=O)Nc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C20H20N2O3S/c1-14-7-9-16(10-8-14)12-26-13-19(23)25-15(2)20(24)22-18-6-4-3-5-17(18)11-21/h3-10,15H,12-13H2,1-2H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | RSVCSZKWJHYNFU-HNNXBMFYSA-N |
| XLogP | 3.67 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |