C18H14Cl2N2O3 — CID 8013529
[(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-(2,6-dichlorophenyl)acetate (PubChem CID 8013529) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-(2,6-dichlorophenyl)acetate.
| Compound Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-(2,6-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 8013529 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-(2,6-dichlorophenyl)acetate |
| SMILES | C[C@@H](OC(=O)Cc1c(Cl)cccc1Cl)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C18H14Cl2N2O3/c1-11(18(24)22-16-8-3-2-5-12(16)10-21)25-17(23)9-13-14(19)6-4-7-15(13)20/h2-8,11H,9H2,1H3,(H,22,24)/t11-/m1/s1 |
| InChIKey | ROWDRMHPVJKLSX-LLVKDONJSA-N |
| XLogP | 3.98 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |