C23H19ClFNO3 — CID 42968519
[1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(2-chloro-6-fluorophenyl)acetate (PubChem CID 42968519) has the molecular formula C23H19ClFNO3 and a molecular weight of 411.86 g/mol. Its IUPAC name is [1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(2-chloro-6-fluorophenyl)acetate.
| Compound Name | [1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(2-chloro-6-fluorophenyl)acetate |
|---|---|
| PubChem CID | 42968519 |
| Molecular Formula | C23H19ClFNO3 |
| Molecular Weight | 411.86 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | [1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(2-chloro-6-fluorophenyl)acetate |
| SMILES | CC(OC(=O)Cc1c(F)cccc1Cl)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C23H19ClFNO3/c1-15(29-22(27)14-18-19(24)11-7-12-20(18)25)23(28)26-21-13-6-5-10-17(21)16-8-3-2-4-9-16/h2-13,15H,14H2,1H3,(H,26,28) |
| InChIKey | WVLPREIYZZTHHV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.86 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |