C23H20FNO4 — CID 7791471
[(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(4-fluorophenoxy)acetate (PubChem CID 7791471) has the molecular formula C23H20FNO4 and a molecular weight of 393.41 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(4-fluorophenoxy)acetate.
| Compound Name | [(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 7791471 |
| Molecular Formula | C23H20FNO4 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(4-fluorophenoxy)acetate |
| SMILES | C[C@H](OC(=O)COc1ccc(F)cc1)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C23H20FNO4/c1-16(29-22(26)15-28-19-13-11-18(24)12-14-19)23(27)25-21-10-6-5-9-20(21)17-7-3-2-4-8-17/h2-14,16H,15H2,1H3,(H,25,27)/t16-/m0/s1 |
| InChIKey | VXBCGSIQYVTUJA-INIZCTEOSA-N |
| XLogP | 4.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |