C25H25NO4 — CID 18273755
[1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(4-ethylphenoxy)acetate (PubChem CID 18273755) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is [1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(4-ethylphenoxy)acetate.
| Compound Name | [1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(4-ethylphenoxy)acetate |
|---|---|
| PubChem CID | 18273755 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(4-ethylphenoxy)acetate |
| SMILES | CCc1ccc(OCC(=O)OC(C)C(=O)Nc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO4/c1-3-19-13-15-21(16-14-19)29-17-24(27)30-18(2)25(28)26-23-12-8-7-11-22(23)20-9-5-4-6-10-20/h4-16,18H,3,17H2,1-2H3,(H,26,28) |
| InChIKey | LHKYDCPRBPPOFR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |