C17H19N3O3S2 — CID 8660645
[(2S)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-(pyrrolidine-1-carbothioylsulfanyl)acetate (PubChem CID 8660645) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is [(2S)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-(pyrrolidine-1-carbothioylsulfanyl)acetate.
| Compound Name | [(2S)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-(pyrrolidine-1-carbothioylsulfanyl)acetate |
|---|---|
| PubChem CID | 8660645 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [(2S)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-(pyrrolidine-1-carbothioylsulfanyl)acetate |
| SMILES | C[C@H](OC(=O)CSC(=S)N1CCCC1)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C17H19N3O3S2/c1-12(16(22)19-14-7-3-2-6-13(14)10-18)23-15(21)11-25-17(24)20-8-4-5-9-20/h2-3,6-7,12H,4-5,8-9,11H2,1H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | SLPRQUMHAYIHAS-LBPRGKRZSA-N |
| XLogP | 2.54 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|