C17H20F2N2O4S2 — CID 8959990
[(2R)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 2-(pyrrolidine-1-carbothioylsulfanyl)acetate (PubChem CID 8959990) has the molecular formula C17H20F2N2O4S2 and a molecular weight of 418.49 g/mol. Its IUPAC name is [(2R)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 2-(pyrrolidine-1-carbothioylsulfanyl)acetate.
| Compound Name | [(2R)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 2-(pyrrolidine-1-carbothioylsulfanyl)acetate |
|---|---|
| PubChem CID | 8959990 |
| Molecular Formula | C17H20F2N2O4S2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [(2R)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 2-(pyrrolidine-1-carbothioylsulfanyl)acetate |
| SMILES | C[C@@H](OC(=O)CSC(=S)N1CCCC1)C(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C17H20F2N2O4S2/c1-11(24-14(22)10-27-17(26)21-8-4-5-9-21)15(23)20-12-6-2-3-7-13(12)25-16(18)19/h2-3,6-7,11,16H,4-5,8-10H2,1H3,(H,20,23)/t11-/m1/s1 |
| InChIKey | LQPMLMTUPCZDJZ-LLVKDONJSA-N |
| XLogP | 3.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|