C14H23N3O4S2 — CID 8960000
[(2R)-1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 2-(pyrrolidine-1-carbothioylsulfanyl)acetate (PubChem CID 8960000) has the molecular formula C14H23N3O4S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 2-(pyrrolidine-1-carbothioylsulfanyl)acetate.
| Compound Name | [(2R)-1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 2-(pyrrolidine-1-carbothioylsulfanyl)acetate |
|---|---|
| PubChem CID | 8960000 |
| Molecular Formula | C14H23N3O4S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | [(2R)-1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 2-(pyrrolidine-1-carbothioylsulfanyl)acetate |
| SMILES | CC(C)NC(=O)NC(=O)[C@@H](C)OC(=O)CSC(=S)N1CCCC1 |
| InChI | InChI=1S/C14H23N3O4S2/c1-9(2)15-13(20)16-12(19)10(3)21-11(18)8-23-14(22)17-6-4-5-7-17/h9-10H,4-8H2,1-3H3,(H2,15,16,19,20)/t10-/m1/s1 |
| InChIKey | PCZPGLUGYVWTGG-SNVBAGLBSA-N |
| XLogP | 1.27 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|