C20H26N2O4S2 — CID 8722179
[(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate (PubChem CID 8722179) has the molecular formula C20H26N2O4S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is [(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate.
| Compound Name | [(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate |
|---|---|
| PubChem CID | 8722179 |
| Molecular Formula | C20H26N2O4S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate |
| SMILES | CC(=O)c1cccc(NC(=O)[C@H](C)OC(=O)CSC(=S)N2CCC(C)CC2)c1 |
| InChI | InChI=1S/C20H26N2O4S2/c1-13-7-9-22(10-8-13)20(27)28-12-18(24)26-15(3)19(25)21-17-6-4-5-16(11-17)14(2)23/h4-6,11,13,15H,7-10,12H2,1-3H3,(H,21,25)/t15-/m0/s1 |
| InChIKey | VIIYHBNOCRFZLV-HNNXBMFYSA-N |
| XLogP | 3.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|