C19H24N2O4S2 — CID 8722124
[2-(3-acetylanilino)-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate (PubChem CID 8722124) has the molecular formula C19H24N2O4S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate |
|---|---|
| PubChem CID | 8722124 |
| Molecular Formula | C19H24N2O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate |
| SMILES | CC(=O)c1cccc(NC(=O)COC(=O)CSC(=S)N2CCC(C)CC2)c1 |
| InChI | InChI=1S/C19H24N2O4S2/c1-13-6-8-21(9-7-13)19(26)27-12-18(24)25-11-17(23)20-16-5-3-4-15(10-16)14(2)22/h3-5,10,13H,6-9,11-12H2,1-2H3,(H,20,23) |
| InChIKey | CPXBINBUPIAPTN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|