C19H25FN2O3S2 — CID 55391783
[2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate (PubChem CID 55391783) has the molecular formula C19H25FN2O3S2 and a molecular weight of 412.55 g/mol. Its IUPAC name is [2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate.
| Compound Name | [2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate |
|---|---|
| PubChem CID | 55391783 |
| Molecular Formula | C19H25FN2O3S2 |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate |
| SMILES | CC1CCN(C(=S)SCC(=O)OCC(=O)N(C)Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H25FN2O3S2/c1-14-6-8-22(9-7-14)19(26)27-13-18(24)25-12-17(23)21(2)11-15-4-3-5-16(20)10-15/h3-5,10,14H,6-9,11-13H2,1-2H3 |
| InChIKey | ZLSVIYLARKGXEY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|