C21H24FNO4 — CID 55380147
[2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(4-propan-2-ylphenoxy)acetate (PubChem CID 55380147) has the molecular formula C21H24FNO4 and a molecular weight of 373.42 g/mol. Its IUPAC name is [2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(4-propan-2-ylphenoxy)acetate.
| Compound Name | [2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(4-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 55380147 |
| Molecular Formula | C21H24FNO4 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-(4-propan-2-ylphenoxy)acetate |
| SMILES | CC(C)c1ccc(OCC(=O)OCC(=O)N(C)Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C21H24FNO4/c1-15(2)17-7-9-19(10-8-17)26-14-21(25)27-13-20(24)23(3)12-16-5-4-6-18(22)11-16/h4-11,15H,12-14H2,1-3H3 |
| InChIKey | XYZCRKJCAPWTEJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |