C19H19ClFNO4 — CID 55373200
[1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 2-(3-chlorophenoxy)acetate (PubChem CID 55373200) has the molecular formula C19H19ClFNO4 and a molecular weight of 379.82 g/mol. Its IUPAC name is [1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 2-(3-chlorophenoxy)acetate.
| Compound Name | [1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 2-(3-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 55373200 |
| Molecular Formula | C19H19ClFNO4 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 2-(3-chlorophenoxy)acetate |
| SMILES | CC(OC(=O)COc1cccc(Cl)c1)C(=O)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C19H19ClFNO4/c1-13(19(24)22(2)11-14-5-3-7-16(21)9-14)26-18(23)12-25-17-8-4-6-15(20)10-17/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | KSPGYDNISHWGAC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |