C18H20FNO2 — CID 86975850
N-[(3-fluorophenyl)methyl]-N-methyl-4-phenoxybutanamide (PubChem CID 86975850) has the molecular formula C18H20FNO2 and a molecular weight of 301.36 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N-methyl-4-phenoxybutanamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-N-methyl-4-phenoxybutanamide |
|---|---|
| PubChem CID | 86975850 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N-methyl-4-phenoxybutanamide |
| SMILES | CN(Cc1cccc(F)c1)C(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C18H20FNO2/c1-20(14-15-7-5-8-16(19)13-15)18(21)11-6-12-22-17-9-3-2-4-10-17/h2-5,7-10,13H,6,11-12,14H2,1H3 |
| InChIKey | DFHCUCPHGBELTC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|