C19H19F4NO2 — CID 55929431
4-(3-fluorophenoxy)-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide (PubChem CID 55929431) has the molecular formula C19H19F4NO2 and a molecular weight of 369.36 g/mol. Its IUPAC name is 4-(3-fluorophenoxy)-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide.
| Compound Name | 4-(3-fluorophenoxy)-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 55929431 |
| Molecular Formula | C19H19F4NO2 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 4-(3-fluorophenoxy)-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide |
| SMILES | CN(Cc1ccc(C(F)(F)F)cc1)C(=O)CCCOc1cccc(F)c1 |
| InChI | InChI=1S/C19H19F4NO2/c1-24(13-14-7-9-15(10-8-14)19(21,22)23)18(25)6-3-11-26-17-5-2-4-16(20)12-17/h2,4-5,7-10,12H,3,6,11,13H2,1H3 |
| InChIKey | YGGWQMINQGCGSR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|