C19H20BrF2NO3 — CID 55344255
4-(3-bromophenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylbutanamide (PubChem CID 55344255) has the molecular formula C19H20BrF2NO3 and a molecular weight of 428.27 g/mol. Its IUPAC name is 4-(3-bromophenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylbutanamide.
| Compound Name | 4-(3-bromophenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 55344255 |
| Molecular Formula | C19H20BrF2NO3 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 4-(3-bromophenoxy)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylbutanamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)CCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C19H20BrF2NO3/c1-23(13-14-7-9-16(10-8-14)26-19(21)22)18(24)6-3-11-25-17-5-2-4-15(20)12-17/h2,4-5,7-10,12,19H,3,6,11,13H2,1H3 |
| InChIKey | PDHCHAMZCQNAEX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|