C12H18ClFN2O — CID 119267070
4-amino-N-[(3-fluorophenyl)methyl]-N-methylbutanamide;hydrochloride (PubChem CID 119267070) has the molecular formula C12H18ClFN2O and a molecular weight of 260.74 g/mol. Its IUPAC name is 4-amino-N-[(3-fluorophenyl)methyl]-N-methylbutanamide;hydrochloride.
| Compound Name | 4-amino-N-[(3-fluorophenyl)methyl]-N-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119267070 |
| Molecular Formula | C12H18ClFN2O |
| Molecular Weight | 260.74 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 4-amino-N-[(3-fluorophenyl)methyl]-N-methylbutanamide;hydrochloride |
| SMILES | CN(Cc1cccc(F)c1)C(=O)CCCN.Cl |
| InChI | InChI=1S/C12H17FN2O.ClH/c1-15(12(16)6-3-7-14)9-10-4-2-5-11(13)8-10;/h2,4-5,8H,3,6-7,9,14H2,1H3;1H |
| InChIKey | HZGSINHYHQWPLI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.74 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |