C19H26N2O3S2 — CID 8722135
[2-(3,4-dimethylanilino)-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate (PubChem CID 8722135) has the molecular formula C19H26N2O3S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate.
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate |
|---|---|
| PubChem CID | 8722135 |
| Molecular Formula | C19H26N2O3S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CSC(=S)N2CCC(C)CC2)cc1C |
| InChI | InChI=1S/C19H26N2O3S2/c1-13-6-8-21(9-7-13)19(25)26-12-18(23)24-11-17(22)20-16-5-4-14(2)15(3)10-16/h4-5,10,13H,6-9,11-12H2,1-3H3,(H,20,22) |
| InChIKey | JRBONHNMKRVUKL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|