C18H20ClF3N2O3S2 — CID 27737938
[2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate (PubChem CID 27737938) has the molecular formula C18H20ClF3N2O3S2 and a molecular weight of 468.95 g/mol. Its IUPAC name is [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate.
| Compound Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate |
|---|---|
| PubChem CID | 27737938 |
| Molecular Formula | C18H20ClF3N2O3S2 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-(4-methylpiperidine-1-carbothioyl)sulfanylacetate |
| SMILES | CC1CCN(C(=S)SCC(=O)OCC(=O)Nc2c(Cl)cccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H20ClF3N2O3S2/c1-11-5-7-24(8-6-11)17(28)29-10-15(26)27-9-14(25)23-16-12(18(20,21)22)3-2-4-13(16)19/h2-4,11H,5-10H2,1H3,(H,23,25) |
| InChIKey | RJZTXCBRPWRWMH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|