C17H23F2N3O5 — CID 9308291
[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 6-(carbamoylamino)hexanoate (PubChem CID 9308291) has the molecular formula C17H23F2N3O5 and a molecular weight of 387.38 g/mol. Its IUPAC name is [(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 6-(carbamoylamino)hexanoate.
| Compound Name | [(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 6-(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 9308291 |
| Molecular Formula | C17H23F2N3O5 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | [(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 6-(carbamoylamino)hexanoate |
| SMILES | C[C@H](OC(=O)CCCCCNC(N)=O)C(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C17H23F2N3O5/c1-11(26-14(23)9-3-2-6-10-21-17(20)25)15(24)22-12-7-4-5-8-13(12)27-16(18)19/h4-5,7-8,11,16H,2-3,6,9-10H2,1H3,(H,22,24)(H3,20,21,25)/t11-/m0/s1 |
| InChIKey | QNQCIGRMZICXFE-NSHDSACASA-N |
| XLogP | 2.39 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|