C19H21N3O4S — CID 8955477
[(2R)-1-oxo-1-(2-phenylsulfanylanilino)propan-2-yl] 3-(carbamoylamino)propanoate (PubChem CID 8955477) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2-phenylsulfanylanilino)propan-2-yl] 3-(carbamoylamino)propanoate.
| Compound Name | [(2R)-1-oxo-1-(2-phenylsulfanylanilino)propan-2-yl] 3-(carbamoylamino)propanoate |
|---|---|
| PubChem CID | 8955477 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [(2R)-1-oxo-1-(2-phenylsulfanylanilino)propan-2-yl] 3-(carbamoylamino)propanoate |
| SMILES | C[C@@H](OC(=O)CCNC(N)=O)C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C19H21N3O4S/c1-13(26-17(23)11-12-21-19(20)25)18(24)22-15-9-5-6-10-16(15)27-14-7-3-2-4-8-14/h2-10,13H,11-12H2,1H3,(H,22,24)(H3,20,21,25)/t13-/m1/s1 |
| InChIKey | FHVCYBJKARERNB-CYBMUJFWSA-N |
| XLogP | 2.77 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |