C18H27N3O5 — CID 9308275
[(2S)-1-(2-methoxy-5-methylanilino)-1-oxopropan-2-yl] 6-(carbamoylamino)hexanoate (PubChem CID 9308275) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-5-methylanilino)-1-oxopropan-2-yl] 6-(carbamoylamino)hexanoate.
| Compound Name | [(2S)-1-(2-methoxy-5-methylanilino)-1-oxopropan-2-yl] 6-(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 9308275 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [(2S)-1-(2-methoxy-5-methylanilino)-1-oxopropan-2-yl] 6-(carbamoylamino)hexanoate |
| SMILES | COc1ccc(C)cc1NC(=O)[C@H](C)OC(=O)CCCCCNC(N)=O |
| InChI | InChI=1S/C18H27N3O5/c1-12-8-9-15(25-3)14(11-12)21-17(23)13(2)26-16(22)7-5-4-6-10-20-18(19)24/h8-9,11,13H,4-7,10H2,1-3H3,(H,21,23)(H3,19,20,24)/t13-/m0/s1 |
| InChIKey | VRLPPLYBGPNCQE-ZDUSSCGKSA-N |
| XLogP | 2.10 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|