C21H24ClNO5 — CID 7147758
[(2S)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 4-(4-methylphenoxy)butanoate (PubChem CID 7147758) has the molecular formula C21H24ClNO5 and a molecular weight of 405.88 g/mol. Its IUPAC name is [(2S)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 4-(4-methylphenoxy)butanoate.
| Compound Name | [(2S)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 4-(4-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 7147758 |
| Molecular Formula | C21H24ClNO5 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | [(2S)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 4-(4-methylphenoxy)butanoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)[C@H](C)OC(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C21H24ClNO5/c1-14-6-9-17(10-7-14)27-12-4-5-20(24)28-15(2)21(25)23-18-13-16(22)8-11-19(18)26-3/h6-11,13,15H,4-5,12H2,1-3H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | BATAYEROCQZKHU-HNNXBMFYSA-N |
| XLogP | 4.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|