C21H24ClNO6 — CID 7147098
[(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 4-(4-methoxyphenoxy)butanoate (PubChem CID 7147098) has the molecular formula C21H24ClNO6 and a molecular weight of 421.88 g/mol. Its IUPAC name is [(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 4-(4-methoxyphenoxy)butanoate.
| Compound Name | [(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 4-(4-methoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 7147098 |
| Molecular Formula | C21H24ClNO6 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 4-(4-methoxyphenoxy)butanoate |
| SMILES | COc1ccc(OCCCC(=O)O[C@H](C)C(=O)Nc2cc(Cl)ccc2OC)cc1 |
| InChI | InChI=1S/C21H24ClNO6/c1-14(21(25)23-18-13-15(22)6-11-19(18)27-3)29-20(24)5-4-12-28-17-9-7-16(26-2)8-10-17/h6-11,13-14H,4-5,12H2,1-3H3,(H,23,25)/t14-/m1/s1 |
| InChIKey | SZQFPARSNZJGNP-CQSZACIVSA-N |
| XLogP | 4.09 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|