C20H22ClNO5 — CID 7146984
[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 4-(4-methoxyphenoxy)butanoate (PubChem CID 7146984) has the molecular formula C20H22ClNO5 and a molecular weight of 391.85 g/mol. Its IUPAC name is [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 4-(4-methoxyphenoxy)butanoate.
| Compound Name | [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 4-(4-methoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 7146984 |
| Molecular Formula | C20H22ClNO5 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 4-(4-methoxyphenoxy)butanoate |
| SMILES | COc1ccc(OCCCC(=O)O[C@H](C)C(=O)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H22ClNO5/c1-14(20(24)22-16-6-3-5-15(21)13-16)27-19(23)7-4-12-26-18-10-8-17(25-2)9-11-18/h3,5-6,8-11,13-14H,4,7,12H2,1-2H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | NXOQXSGTEWVOMJ-CQSZACIVSA-N |
| XLogP | 4.08 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|