C20H21Cl2NO4 — CID 7199740
[(2S)-1-(4-chloroanilino)-1-oxopropan-2-yl] 4-(4-chloro-3-methylphenoxy)butanoate (PubChem CID 7199740) has the molecular formula C20H21Cl2NO4 and a molecular weight of 410.30 g/mol. Its IUPAC name is [(2S)-1-(4-chloroanilino)-1-oxopropan-2-yl] 4-(4-chloro-3-methylphenoxy)butanoate.
| Compound Name | [(2S)-1-(4-chloroanilino)-1-oxopropan-2-yl] 4-(4-chloro-3-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 7199740 |
| Molecular Formula | C20H21Cl2NO4 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [(2S)-1-(4-chloroanilino)-1-oxopropan-2-yl] 4-(4-chloro-3-methylphenoxy)butanoate |
| SMILES | Cc1cc(OCCCC(=O)O[C@@H](C)C(=O)Nc2ccc(Cl)cc2)ccc1Cl |
| InChI | InChI=1S/C20H21Cl2NO4/c1-13-12-17(9-10-18(13)22)26-11-3-4-19(24)27-14(2)20(25)23-16-7-5-15(21)6-8-16/h5-10,12,14H,3-4,11H2,1-2H3,(H,23,25)/t14-/m0/s1 |
| InChIKey | YFFTXQPLSGNERO-AWEZNQCLSA-N |
| XLogP | 5.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|