C20H26ClN3O4 — CID 8743239
[(2S)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] 4-(4-chloro-3-methylphenoxy)butanoate (PubChem CID 8743239) has the molecular formula C20H26ClN3O4 and a molecular weight of 407.90 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] 4-(4-chloro-3-methylphenoxy)butanoate.
| Compound Name | [(2S)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] 4-(4-chloro-3-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 8743239 |
| Molecular Formula | C20H26ClN3O4 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [(2S)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] 4-(4-chloro-3-methylphenoxy)butanoate |
| SMILES | Cc1cc(OCCCC(=O)O[C@@H](C)C(=O)Nc2c(C)nn(C)c2C)ccc1Cl |
| InChI | InChI=1S/C20H26ClN3O4/c1-12-11-16(8-9-17(12)21)27-10-6-7-18(25)28-15(4)20(26)22-19-13(2)23-24(5)14(19)3/h8-9,11,15H,6-7,10H2,1-5H3,(H,22,26)/t15-/m0/s1 |
| InChIKey | SCTLQOXYKFVJET-HNNXBMFYSA-N |
| XLogP | 3.73 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|