C26H33NO7 — CID 16503892
[1-(2,5-dimethoxyanilino)-1-oxopropan-2-yl] 4-oxo-4-(4-pentoxyphenyl)butanoate (PubChem CID 16503892) has the molecular formula C26H33NO7 and a molecular weight of 471.55 g/mol. Its IUPAC name is [1-(2,5-dimethoxyanilino)-1-oxopropan-2-yl] 4-oxo-4-(4-pentoxyphenyl)butanoate.
| Compound Name | [1-(2,5-dimethoxyanilino)-1-oxopropan-2-yl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
|---|---|
| PubChem CID | 16503892 |
| Molecular Formula | C26H33NO7 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | [1-(2,5-dimethoxyanilino)-1-oxopropan-2-yl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)OC(C)C(=O)Nc2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C26H33NO7/c1-5-6-7-16-33-20-10-8-19(9-11-20)23(28)13-15-25(29)34-18(2)26(30)27-22-17-21(31-3)12-14-24(22)32-4/h8-12,14,17-18H,5-7,13,15-16H2,1-4H3,(H,27,30) |
| InChIKey | ZMPLOKMCSKAUJY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|