C24H27F2NO5 — CID 46622273
[1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 4-oxo-4-(4-pentoxyphenyl)butanoate (PubChem CID 46622273) has the molecular formula C24H27F2NO5 and a molecular weight of 447.48 g/mol. Its IUPAC name is [1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 4-oxo-4-(4-pentoxyphenyl)butanoate.
| Compound Name | [1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
|---|---|
| PubChem CID | 46622273 |
| Molecular Formula | C24H27F2NO5 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | [1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)OC(C)C(=O)Nc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C24H27F2NO5/c1-3-4-5-15-31-18-11-9-17(10-12-18)21(28)13-14-22(29)32-16(2)24(30)27-23-19(25)7-6-8-20(23)26/h6-12,16H,3-5,13-15H2,1-2H3,(H,27,30) |
| InChIKey | GUMSNVPFYMIPSN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|