C15H15N3O4S — CID 9003574
[(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 9003574) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate.
| Compound Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 9003574 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | C[C@@H](OC(=O)CN1CCSC1=O)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C15H15N3O4S/c1-10(22-13(19)9-18-6-7-23-15(18)21)14(20)17-12-5-3-2-4-11(12)8-16/h2-5,10H,6-7,9H2,1H3,(H,17,20)/t10-/m1/s1 |
| InChIKey | XZJYJGHBHCQTHL-SNVBAGLBSA-N |
| XLogP | 1.60 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|