C15H15F3N2O5S — CID 9003566
[(2R)-1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 9003566) has the molecular formula C15H15F3N2O5S and a molecular weight of 392.36 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate.
| Compound Name | [(2R)-1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 9003566 |
| Molecular Formula | C15H15F3N2O5S |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | [(2R)-1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | C[C@@H](OC(=O)CN1CCSC1=O)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H15F3N2O5S/c1-9(24-12(21)8-20-6-7-26-14(20)23)13(22)19-10-2-4-11(5-3-10)25-15(16,17)18/h2-5,9H,6-8H2,1H3,(H,19,22)/t9-/m1/s1 |
| InChIKey | QLJBWURXHOGOGS-SECBINFHSA-N |
| XLogP | 2.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|