C17H18F3NO4 — CID 9065896
[(2R)-1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 2-[(1R)-cyclopent-2-en-1-yl]acetate (PubChem CID 9065896) has the molecular formula C17H18F3NO4 and a molecular weight of 357.33 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 2-[(1R)-cyclopent-2-en-1-yl]acetate.
| Compound Name | [(2R)-1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 2-[(1R)-cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 9065896 |
| Molecular Formula | C17H18F3NO4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [(2R)-1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 2-[(1R)-cyclopent-2-en-1-yl]acetate |
| SMILES | C[C@@H](OC(=O)C[C@@H]1C=CCC1)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H18F3NO4/c1-11(24-15(22)10-12-4-2-3-5-12)16(23)21-13-6-8-14(9-7-13)25-17(18,19)20/h2,4,6-9,11-12H,3,5,10H2,1H3,(H,21,23)/t11-,12-/m1/s1 |
| InChIKey | JLSPIESGDAXUQJ-VXGBXAGGSA-N |
| XLogP | 3.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|