C22H19F3N2O6 — CID 46816608
[1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 46816608) has the molecular formula C22H19F3N2O6 and a molecular weight of 464.40 g/mol. Its IUPAC name is [1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 46816608 |
| Molecular Formula | C22H19F3N2O6 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | [1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC(=O)OC(C)C(=O)Nc1ccc(OC(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C22H19F3N2O6/c1-12-3-8-16-17(11-12)21(31)27(20(16)30)10-9-18(28)32-13(2)19(29)26-14-4-6-15(7-5-14)33-22(23,24)25/h3-8,11,13H,9-10H2,1-2H3,(H,26,29) |
| InChIKey | ZJGWKMBQRBSOSF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|