C26H23N3O4S — CID 42973205
[1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 42973205) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is [1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 42973205 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | Cc1ccc(NC(=O)CSc2ccccc2C(=O)OC(C)C(=O)Nc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C26H23N3O4S/c1-17-11-13-20(14-12-17)28-24(30)16-34-23-10-6-4-8-21(23)26(32)33-18(2)25(31)29-22-9-5-3-7-19(22)15-27/h3-14,18H,16H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | UFYPGZUBQPWBFW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |