C19H18N2O3S — CID 18276517
1-cyanoethyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 18276517) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is 1-cyanoethyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | 1-cyanoethyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 18276517 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 1-cyanoethyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | Cc1ccc(NC(=O)CSc2ccccc2C(=O)OC(C)C#N)cc1 |
| InChI | InChI=1S/C19H18N2O3S/c1-13-7-9-15(10-8-13)21-18(22)12-25-17-6-4-3-5-16(17)19(23)24-14(2)11-20/h3-10,14H,12H2,1-2H3,(H,21,22) |
| InChIKey | ZUDPHJATPFVNRE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |